N-{3-[(propan-2-yl)oxy]propyl}-5-[4-(pyrrolidine-1-sulfonyl)phenyl]-1,3,4-oxadiazole-2-carboxamide
Chemical Structure Depiction of
N-{3-[(propan-2-yl)oxy]propyl}-5-[4-(pyrrolidine-1-sulfonyl)phenyl]-1,3,4-oxadiazole-2-carboxamide
N-{3-[(propan-2-yl)oxy]propyl}-5-[4-(pyrrolidine-1-sulfonyl)phenyl]-1,3,4-oxadiazole-2-carboxamide
Compound characteristics
| Compound ID: | L957-0173 |
| Compound Name: | N-{3-[(propan-2-yl)oxy]propyl}-5-[4-(pyrrolidine-1-sulfonyl)phenyl]-1,3,4-oxadiazole-2-carboxamide |
| Molecular Weight: | 422.5 |
| Molecular Formula: | C19 H26 N4 O5 S |
| Smiles: | CC(C)OCCCNC(c1nnc(c2ccc(cc2)S(N2CCCC2)(=O)=O)o1)=O |
| Stereo: | ACHIRAL |
| logP: | 1.401 |
| logD: | 1.401 |
| logSw: | -2.4074 |
| Hydrogen bond acceptors count: | 11 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 94.559 |
| InChI Key: | FEZHVTIAAGCLIV-UHFFFAOYSA-N |