5-[4-(dimethylsulfamoyl)phenyl]-N-[1-(4-methoxyphenyl)ethyl]-1,3,4-oxadiazole-2-carboxamide
					Chemical Structure Depiction of
5-[4-(dimethylsulfamoyl)phenyl]-N-[1-(4-methoxyphenyl)ethyl]-1,3,4-oxadiazole-2-carboxamide
			5-[4-(dimethylsulfamoyl)phenyl]-N-[1-(4-methoxyphenyl)ethyl]-1,3,4-oxadiazole-2-carboxamide
Compound characteristics
| Compound ID: | L957-1769 | 
| Compound Name: | 5-[4-(dimethylsulfamoyl)phenyl]-N-[1-(4-methoxyphenyl)ethyl]-1,3,4-oxadiazole-2-carboxamide | 
| Molecular Weight: | 430.48 | 
| Molecular Formula: | C20 H22 N4 O5 S | 
| Smiles: | CC(c1ccc(cc1)OC)NC(c1nnc(c2ccc(cc2)S(N(C)C)(=O)=O)o1)=O | 
| Stereo: | RACEMIC MIXTURE | 
| logP: | 2.0697 | 
| logD: | 2.0697 | 
| logSw: | -2.7629 | 
| Hydrogen bond acceptors count: | 11 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 95.538 | 
| InChI Key: | XANVWVSTQNUVGN-ZDUSSCGKSA-N | 
 
				 
				