5-[4-(dimethylsulfamoyl)phenyl]-N-[1-(4-ethylphenyl)ethyl]-1,3,4-oxadiazole-2-carboxamide
Chemical Structure Depiction of
5-[4-(dimethylsulfamoyl)phenyl]-N-[1-(4-ethylphenyl)ethyl]-1,3,4-oxadiazole-2-carboxamide
5-[4-(dimethylsulfamoyl)phenyl]-N-[1-(4-ethylphenyl)ethyl]-1,3,4-oxadiazole-2-carboxamide
Compound characteristics
| Compound ID: | L957-1775 |
| Compound Name: | 5-[4-(dimethylsulfamoyl)phenyl]-N-[1-(4-ethylphenyl)ethyl]-1,3,4-oxadiazole-2-carboxamide |
| Molecular Weight: | 428.51 |
| Molecular Formula: | C21 H24 N4 O4 S |
| Smiles: | CCc1ccc(cc1)C(C)NC(c1nnc(c2ccc(cc2)S(N(C)C)(=O)=O)o1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.018 |
| logD: | 3.018 |
| logSw: | -3.5377 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 87.994 |
| InChI Key: | JZFYXGUWEOGFPU-AWEZNQCLSA-N |