2-{2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-1H-pyrrol-1-yl}-1-(2,3-dihydro-1H-indol-1-yl)ethan-1-one
Chemical Structure Depiction of
2-{2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-1H-pyrrol-1-yl}-1-(2,3-dihydro-1H-indol-1-yl)ethan-1-one
2-{2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-1H-pyrrol-1-yl}-1-(2,3-dihydro-1H-indol-1-yl)ethan-1-one
Compound characteristics
| Compound ID: | L958-1016 |
| Compound Name: | 2-{2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-1H-pyrrol-1-yl}-1-(2,3-dihydro-1H-indol-1-yl)ethan-1-one |
| Molecular Weight: | 419.93 |
| Molecular Formula: | C23 H18 Cl N3 O S |
| Smiles: | C1CN(C(Cn2cccc2c2nc(cs2)c2ccc(cc2)[Cl])=O)c2ccccc12 |
| Stereo: | ACHIRAL |
| logP: | 5.972 |
| logD: | 5.972 |
| logSw: | -6.2139 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 26.7132 |
| InChI Key: | PCGFJUMRGQJWIZ-UHFFFAOYSA-N |