ethyl 1-({2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-1H-pyrrol-1-yl}acetyl)piperidine-3-carboxylate
Chemical Structure Depiction of
ethyl 1-({2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-1H-pyrrol-1-yl}acetyl)piperidine-3-carboxylate
ethyl 1-({2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-1H-pyrrol-1-yl}acetyl)piperidine-3-carboxylate
Compound characteristics
| Compound ID: | L958-1104 |
| Compound Name: | ethyl 1-({2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-1H-pyrrol-1-yl}acetyl)piperidine-3-carboxylate |
| Molecular Weight: | 457.98 |
| Molecular Formula: | C23 H24 Cl N3 O3 S |
| Smiles: | CCOC(C1CCCN(C1)C(Cn1cccc1c1nc(cs1)c1ccc(cc1)[Cl])=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.1633 |
| logD: | 5.1633 |
| logSw: | -5.7166 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 48.37 |
| InChI Key: | LPVBKXMETFNZOO-KRWDZBQOSA-N |