2-{2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-1H-pyrrol-1-yl}-1-[4-(furan-2-carbonyl)piperazin-1-yl]ethan-1-one
Chemical Structure Depiction of
2-{2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-1H-pyrrol-1-yl}-1-[4-(furan-2-carbonyl)piperazin-1-yl]ethan-1-one
2-{2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-1H-pyrrol-1-yl}-1-[4-(furan-2-carbonyl)piperazin-1-yl]ethan-1-one
Compound characteristics
| Compound ID: | L958-1117 |
| Compound Name: | 2-{2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-1H-pyrrol-1-yl}-1-[4-(furan-2-carbonyl)piperazin-1-yl]ethan-1-one |
| Molecular Weight: | 480.97 |
| Molecular Formula: | C24 H21 Cl N4 O3 S |
| Smiles: | C1CN(CCN1C(Cn1cccc1c1nc(cs1)c1ccc(cc1)[Cl])=O)C(c1ccco1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.3914 |
| logD: | 4.3914 |
| logSw: | -4.7558 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 52.717 |
| InChI Key: | WPQBFHXNEQHGIF-UHFFFAOYSA-N |