methyl 4-(3-acetylanilino)-7-methyl-1,8-naphthyridine-3-carboxylate--hydrogen chloride (1/1)
Chemical Structure Depiction of
methyl 4-(3-acetylanilino)-7-methyl-1,8-naphthyridine-3-carboxylate--hydrogen chloride (1/1)
methyl 4-(3-acetylanilino)-7-methyl-1,8-naphthyridine-3-carboxylate--hydrogen chloride (1/1)
Compound characteristics
| Compound ID: | L967-0381 |
| Compound Name: | methyl 4-(3-acetylanilino)-7-methyl-1,8-naphthyridine-3-carboxylate--hydrogen chloride (1/1) |
| Molecular Weight: | 371.82 |
| Molecular Formula: | C19 H17 N3 O3 |
| Salt: | HCl |
| Smiles: | CC(c1cccc(c1)Nc1c(cnc2c1ccc(C)n2)C(=O)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 3.1905 |
| logD: | 3.19 |
| logSw: | -3.2357 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.357 |
| InChI Key: | WOIIVVBYBFBBAA-UHFFFAOYSA-N |