methyl 4-(3,4-difluoroanilino)-7-methyl-1,8-naphthyridine-3-carboxylate--hydrogen chloride (1/1)
Chemical Structure Depiction of
methyl 4-(3,4-difluoroanilino)-7-methyl-1,8-naphthyridine-3-carboxylate--hydrogen chloride (1/1)
methyl 4-(3,4-difluoroanilino)-7-methyl-1,8-naphthyridine-3-carboxylate--hydrogen chloride (1/1)
Compound characteristics
| Compound ID: | L967-0440 |
| Compound Name: | methyl 4-(3,4-difluoroanilino)-7-methyl-1,8-naphthyridine-3-carboxylate--hydrogen chloride (1/1) |
| Molecular Weight: | 365.76 |
| Molecular Formula: | C17 H13 F2 N3 O2 |
| Salt: | HCl |
| Smiles: | Cc1ccc2c(c(cnc2n1)C(=O)OC)Nc1ccc(c(c1)F)F |
| Stereo: | ACHIRAL |
| logP: | 3.8063 |
| logD: | 3.8057 |
| logSw: | -3.995 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.53 |
| InChI Key: | BDUBZBRDMXQQEN-UHFFFAOYSA-N |