methyl 4-(3-chloro-2-fluoroanilino)-7-methyl-1,8-naphthyridine-3-carboxylate--hydrogen chloride (1/1)
Chemical Structure Depiction of
methyl 4-(3-chloro-2-fluoroanilino)-7-methyl-1,8-naphthyridine-3-carboxylate--hydrogen chloride (1/1)
methyl 4-(3-chloro-2-fluoroanilino)-7-methyl-1,8-naphthyridine-3-carboxylate--hydrogen chloride (1/1)
Compound characteristics
| Compound ID: | L967-0487 |
| Compound Name: | methyl 4-(3-chloro-2-fluoroanilino)-7-methyl-1,8-naphthyridine-3-carboxylate--hydrogen chloride (1/1) |
| Molecular Weight: | 382.22 |
| Molecular Formula: | C17 H13 Cl F N3 O2 |
| Salt: | HCl |
| Smiles: | Cc1ccc2c(c(cnc2n1)C(=O)OC)Nc1cccc(c1F)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.4307 |
| logD: | 4.4302 |
| logSw: | -4.5201 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.832 |
| InChI Key: | WBYLEEUUMOLZMM-UHFFFAOYSA-N |