ethyl 4-(4-bromo-3-methylanilino)-7-methyl-1,8-naphthyridine-3-carboxylate--hydrogen chloride (1/1)
Chemical Structure Depiction of
ethyl 4-(4-bromo-3-methylanilino)-7-methyl-1,8-naphthyridine-3-carboxylate--hydrogen chloride (1/1)
ethyl 4-(4-bromo-3-methylanilino)-7-methyl-1,8-naphthyridine-3-carboxylate--hydrogen chloride (1/1)
Compound characteristics
| Compound ID: | L967-0520 |
| Compound Name: | ethyl 4-(4-bromo-3-methylanilino)-7-methyl-1,8-naphthyridine-3-carboxylate--hydrogen chloride (1/1) |
| Molecular Weight: | 436.73 |
| Molecular Formula: | C19 H18 Br N3 O2 |
| Salt: | HCl |
| Smiles: | CCOC(c1cnc2c(ccc(C)n2)c1Nc1ccc(c(C)c1)[Br])=O |
| Stereo: | ACHIRAL |
| logP: | 5.1679 |
| logD: | 5.1673 |
| logSw: | -4.9723 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.11 |
| InChI Key: | SFPOMYIIEFYOIY-UHFFFAOYSA-N |