ethyl 4-(2,4-dimethylanilino)-7-methyl-1,8-naphthyridine-3-carboxylate--hydrogen chloride (1/1)
Chemical Structure Depiction of
ethyl 4-(2,4-dimethylanilino)-7-methyl-1,8-naphthyridine-3-carboxylate--hydrogen chloride (1/1)
ethyl 4-(2,4-dimethylanilino)-7-methyl-1,8-naphthyridine-3-carboxylate--hydrogen chloride (1/1)
Compound characteristics
| Compound ID: | L967-0538 |
| Compound Name: | ethyl 4-(2,4-dimethylanilino)-7-methyl-1,8-naphthyridine-3-carboxylate--hydrogen chloride (1/1) |
| Molecular Weight: | 371.87 |
| Molecular Formula: | C20 H21 N3 O2 |
| Salt: | HCl |
| Smiles: | CCOC(c1cnc2c(ccc(C)n2)c1Nc1ccc(C)cc1C)=O |
| Stereo: | ACHIRAL |
| logP: | 4.9137 |
| logD: | 4.9132 |
| logSw: | -4.4875 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.412 |
| InChI Key: | YTIUSUNESDSFKM-UHFFFAOYSA-N |