ethyl 4-(4-chloro-2-fluoroanilino)-7-methyl-1,8-naphthyridine-3-carboxylate--hydrogen chloride (1/1)
Chemical Structure Depiction of
ethyl 4-(4-chloro-2-fluoroanilino)-7-methyl-1,8-naphthyridine-3-carboxylate--hydrogen chloride (1/1)
ethyl 4-(4-chloro-2-fluoroanilino)-7-methyl-1,8-naphthyridine-3-carboxylate--hydrogen chloride (1/1)
Compound characteristics
| Compound ID: | L967-0590 |
| Compound Name: | ethyl 4-(4-chloro-2-fluoroanilino)-7-methyl-1,8-naphthyridine-3-carboxylate--hydrogen chloride (1/1) |
| Molecular Weight: | 396.25 |
| Molecular Formula: | C18 H15 Cl F N3 O2 |
| Salt: | HCl |
| Smiles: | CCOC(c1cnc2c(ccc(C)n2)c1Nc1ccc(cc1F)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 5.0529 |
| logD: | 5.0524 |
| logSw: | -5.047 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.412 |
| InChI Key: | JZYAYOKWXDVHNS-UHFFFAOYSA-N |