propan-2-yl 7-methyl-4-[2-(trifluoromethyl)anilino]-1,8-naphthyridine-3-carboxylate--hydrogen chloride (1/1)
Chemical Structure Depiction of
propan-2-yl 7-methyl-4-[2-(trifluoromethyl)anilino]-1,8-naphthyridine-3-carboxylate--hydrogen chloride (1/1)
propan-2-yl 7-methyl-4-[2-(trifluoromethyl)anilino]-1,8-naphthyridine-3-carboxylate--hydrogen chloride (1/1)
Compound characteristics
| Compound ID: | L967-1168 |
| Compound Name: | propan-2-yl 7-methyl-4-[2-(trifluoromethyl)anilino]-1,8-naphthyridine-3-carboxylate--hydrogen chloride (1/1) |
| Molecular Weight: | 425.84 |
| Molecular Formula: | C20 H18 F3 N3 O2 |
| Salt: | HCl |
| Smiles: | CC(C)OC(c1cnc2c(ccc(C)n2)c1Nc1ccccc1C(F)(F)F)=O |
| Stereo: | ACHIRAL |
| logP: | 5.1636 |
| logD: | 5.163 |
| logSw: | -4.9663 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.091 |
| InChI Key: | BIOJCAXKPRXFJT-UHFFFAOYSA-N |