propan-2-yl 4-(5-chloro-2-methoxyanilino)-7-methyl-1,8-naphthyridine-3-carboxylate--hydrogen chloride (1/1)
Chemical Structure Depiction of
propan-2-yl 4-(5-chloro-2-methoxyanilino)-7-methyl-1,8-naphthyridine-3-carboxylate--hydrogen chloride (1/1)
propan-2-yl 4-(5-chloro-2-methoxyanilino)-7-methyl-1,8-naphthyridine-3-carboxylate--hydrogen chloride (1/1)
Compound characteristics
| Compound ID: | L967-1193 |
| Compound Name: | propan-2-yl 4-(5-chloro-2-methoxyanilino)-7-methyl-1,8-naphthyridine-3-carboxylate--hydrogen chloride (1/1) |
| Molecular Weight: | 422.31 |
| Molecular Formula: | C20 H20 Cl N3 O3 |
| Salt: | HCl |
| Smiles: | CC(C)OC(c1cnc2c(ccc(C)n2)c1Nc1cc(ccc1OC)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 4.9008 |
| logD: | 4.9003 |
| logSw: | -4.8901 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.721 |
| InChI Key: | LOHNXBACXISBRD-UHFFFAOYSA-N |