propan-2-yl 4-{[(3-methoxyphenyl)methyl]amino}-7-methyl-1,8-naphthyridine-3-carboxylate
Chemical Structure Depiction of
propan-2-yl 4-{[(3-methoxyphenyl)methyl]amino}-7-methyl-1,8-naphthyridine-3-carboxylate
propan-2-yl 4-{[(3-methoxyphenyl)methyl]amino}-7-methyl-1,8-naphthyridine-3-carboxylate
Compound characteristics
| Compound ID: | L967-1326 |
| Compound Name: | propan-2-yl 4-{[(3-methoxyphenyl)methyl]amino}-7-methyl-1,8-naphthyridine-3-carboxylate |
| Molecular Weight: | 365.43 |
| Molecular Formula: | C21 H23 N3 O3 |
| Smiles: | CC(C)OC(c1cnc2c(ccc(C)n2)c1NCc1cccc(c1)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 3.8073 |
| logD: | 3.8069 |
| logSw: | -3.9619 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.655 |
| InChI Key: | SJHPPGFXVQBHMT-UHFFFAOYSA-N |