1-(3-{[3-(2-ethylpiperidine-1-carbonyl)-7-methyl-1,8-naphthyridin-4-yl]amino}phenyl)ethan-1-one--hydrogen chloride (1/1)
Chemical Structure Depiction of
1-(3-{[3-(2-ethylpiperidine-1-carbonyl)-7-methyl-1,8-naphthyridin-4-yl]amino}phenyl)ethan-1-one--hydrogen chloride (1/1)
1-(3-{[3-(2-ethylpiperidine-1-carbonyl)-7-methyl-1,8-naphthyridin-4-yl]amino}phenyl)ethan-1-one--hydrogen chloride (1/1)
Compound characteristics
| Compound ID: | L968-0593 |
| Compound Name: | 1-(3-{[3-(2-ethylpiperidine-1-carbonyl)-7-methyl-1,8-naphthyridin-4-yl]amino}phenyl)ethan-1-one--hydrogen chloride (1/1) |
| Molecular Weight: | 452.98 |
| Molecular Formula: | C25 H28 N4 O2 |
| Salt: | HCl |
| Smiles: | CCC1CCCCN1C(c1cnc2c(ccc(C)n2)c1Nc1cccc(c1)C(C)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.2495 |
| logD: | 4.2492 |
| logSw: | -4.1292 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.477 |
| InChI Key: | ZYKJTWFIFPADPN-FQEVSTJZSA-N |