(2-ethylpiperidin-1-yl)[4-(3-fluoroanilino)-7-methyl-1,8-naphthyridin-3-yl]methanone--hydrogen chloride (1/1)
Chemical Structure Depiction of
(2-ethylpiperidin-1-yl)[4-(3-fluoroanilino)-7-methyl-1,8-naphthyridin-3-yl]methanone--hydrogen chloride (1/1)
(2-ethylpiperidin-1-yl)[4-(3-fluoroanilino)-7-methyl-1,8-naphthyridin-3-yl]methanone--hydrogen chloride (1/1)
Compound characteristics
| Compound ID: | L968-0599 |
| Compound Name: | (2-ethylpiperidin-1-yl)[4-(3-fluoroanilino)-7-methyl-1,8-naphthyridin-3-yl]methanone--hydrogen chloride (1/1) |
| Molecular Weight: | 428.94 |
| Molecular Formula: | C23 H25 F N4 O |
| Salt: | HCl |
| Smiles: | CCC1CCCCN1C(c1cnc2c(ccc(C)n2)c1Nc1cccc(c1)F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.662 |
| logD: | 4.6616 |
| logSw: | -4.3368 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.651 |
| InChI Key: | JBQBJSGOIVZMGZ-SFHVURJKSA-N |