(2-ethylpiperidin-1-yl)[4-(2-methoxyanilino)-7-methyl-1,8-naphthyridin-3-yl]methanone--hydrogen chloride (1/1)
					Chemical Structure Depiction of
(2-ethylpiperidin-1-yl)[4-(2-methoxyanilino)-7-methyl-1,8-naphthyridin-3-yl]methanone--hydrogen chloride (1/1)
			(2-ethylpiperidin-1-yl)[4-(2-methoxyanilino)-7-methyl-1,8-naphthyridin-3-yl]methanone--hydrogen chloride (1/1)
Compound characteristics
| Compound ID: | L968-0635 | 
| Compound Name: | (2-ethylpiperidin-1-yl)[4-(2-methoxyanilino)-7-methyl-1,8-naphthyridin-3-yl]methanone--hydrogen chloride (1/1) | 
| Molecular Weight: | 440.97 | 
| Molecular Formula: | C24 H28 N4 O2 | 
| Salt: | HCl | 
| Smiles: | CCC1CCCCN1C(c1cnc2c(ccc(C)n2)c1Nc1ccccc1OC)=O | 
| Stereo: | RACEMIC MIXTURE | 
| logP: | 4.6995 | 
| logD: | 4.6991 | 
| logSw: | -4.3553 | 
| Hydrogen bond acceptors count: | 5 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 49.583 | 
| InChI Key: | UUBCXINATFVQFC-KRWDZBQOSA-N | 
 
				 
				