[4-(3-chloroanilino)-7-methyl-1,8-naphthyridin-3-yl](3-methylpiperidin-1-yl)methanone--hydrogen chloride (1/1)
Chemical Structure Depiction of
[4-(3-chloroanilino)-7-methyl-1,8-naphthyridin-3-yl](3-methylpiperidin-1-yl)methanone--hydrogen chloride (1/1)
[4-(3-chloroanilino)-7-methyl-1,8-naphthyridin-3-yl](3-methylpiperidin-1-yl)methanone--hydrogen chloride (1/1)
Compound characteristics
| Compound ID: | L968-0860 |
| Compound Name: | [4-(3-chloroanilino)-7-methyl-1,8-naphthyridin-3-yl](3-methylpiperidin-1-yl)methanone--hydrogen chloride (1/1) |
| Molecular Weight: | 431.36 |
| Molecular Formula: | C22 H23 Cl N4 O |
| Salt: | HCl |
| Smiles: | CC1CCCN(C1)C(c1cnc2c(ccc(C)n2)c1Nc1cccc(c1)[Cl])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.7728 |
| logD: | 4.772 |
| logSw: | -4.8173 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.938 |
| InChI Key: | VHDCPJJFLLQKGB-AWEZNQCLSA-N |