1-(4-{[7-methyl-3-(4-methylpiperidine-1-carbonyl)-1,8-naphthyridin-4-yl]amino}phenyl)ethan-1-one--hydrogen chloride (1/1)
Chemical Structure Depiction of
1-(4-{[7-methyl-3-(4-methylpiperidine-1-carbonyl)-1,8-naphthyridin-4-yl]amino}phenyl)ethan-1-one--hydrogen chloride (1/1)
1-(4-{[7-methyl-3-(4-methylpiperidine-1-carbonyl)-1,8-naphthyridin-4-yl]amino}phenyl)ethan-1-one--hydrogen chloride (1/1)
Compound characteristics
| Compound ID: | L968-0990 |
| Compound Name: | 1-(4-{[7-methyl-3-(4-methylpiperidine-1-carbonyl)-1,8-naphthyridin-4-yl]amino}phenyl)ethan-1-one--hydrogen chloride (1/1) |
| Molecular Weight: | 438.96 |
| Molecular Formula: | C24 H26 N4 O2 |
| Salt: | HCl |
| Smiles: | CC1CCN(CC1)C(c1cnc2c(ccc(C)n2)c1Nc1ccc(cc1)C(C)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.5563 |
| logD: | 3.5555 |
| logSw: | -3.5436 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.831 |
| InChI Key: | NHCLWBGEXLREFS-UHFFFAOYSA-N |