methyl ({6-[(3-methoxybenzene-1-sulfonyl)amino]-2-phenylquinolin-4-yl}oxy)acetate
Chemical Structure Depiction of
methyl ({6-[(3-methoxybenzene-1-sulfonyl)amino]-2-phenylquinolin-4-yl}oxy)acetate
methyl ({6-[(3-methoxybenzene-1-sulfonyl)amino]-2-phenylquinolin-4-yl}oxy)acetate
Compound characteristics
| Compound ID: | L970-0158 |
| Compound Name: | methyl ({6-[(3-methoxybenzene-1-sulfonyl)amino]-2-phenylquinolin-4-yl}oxy)acetate |
| Molecular Weight: | 478.52 |
| Molecular Formula: | C25 H22 N2 O6 S |
| Smiles: | COC(COc1cc(c2ccccc2)nc2ccc(cc12)NS(c1cccc(c1)OC)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5922 |
| logD: | 4.5617 |
| logSw: | -4.4143 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 84.656 |
| InChI Key: | IWSLMJXOYAMQIX-UHFFFAOYSA-N |