N-(3,5-dimethylphenyl)-2-{[3-(3-methylpiperidin-1-yl)pyrazin-2-yl]sulfanyl}acetamide
Chemical Structure Depiction of
N-(3,5-dimethylphenyl)-2-{[3-(3-methylpiperidin-1-yl)pyrazin-2-yl]sulfanyl}acetamide
N-(3,5-dimethylphenyl)-2-{[3-(3-methylpiperidin-1-yl)pyrazin-2-yl]sulfanyl}acetamide
Compound characteristics
| Compound ID: | L981-0128 |
| Compound Name: | N-(3,5-dimethylphenyl)-2-{[3-(3-methylpiperidin-1-yl)pyrazin-2-yl]sulfanyl}acetamide |
| Molecular Weight: | 370.52 |
| Molecular Formula: | C20 H26 N4 O S |
| Smiles: | CC1CCCN(C1)c1c(nccn1)SCC(Nc1cc(C)cc(C)c1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.1251 |
| logD: | 4.1251 |
| logSw: | -4.0959 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.662 |
| InChI Key: | MTQCOVZDEAXIKJ-AWEZNQCLSA-N |