N-(2,3-dimethylphenyl)-2-({3-[4-(4-fluorophenyl)piperazin-1-yl]pyrazin-2-yl}sulfanyl)acetamide
Chemical Structure Depiction of
N-(2,3-dimethylphenyl)-2-({3-[4-(4-fluorophenyl)piperazin-1-yl]pyrazin-2-yl}sulfanyl)acetamide
N-(2,3-dimethylphenyl)-2-({3-[4-(4-fluorophenyl)piperazin-1-yl]pyrazin-2-yl}sulfanyl)acetamide
Compound characteristics
| Compound ID: | L981-0359 |
| Compound Name: | N-(2,3-dimethylphenyl)-2-({3-[4-(4-fluorophenyl)piperazin-1-yl]pyrazin-2-yl}sulfanyl)acetamide |
| Molecular Weight: | 451.57 |
| Molecular Formula: | C24 H26 F N5 O S |
| Smiles: | Cc1cccc(c1C)NC(CSc1c(nccn1)N1CCN(CC1)c1ccc(cc1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 4.7582 |
| logD: | 4.7582 |
| logSw: | -4.3444 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.291 |
| InChI Key: | SSQKGDBRUWXPQV-UHFFFAOYSA-N |