N-(2-chlorophenyl)-2-({3-[4-(2,3-dimethylphenyl)piperazin-1-yl]pyrazin-2-yl}sulfanyl)acetamide
Chemical Structure Depiction of
N-(2-chlorophenyl)-2-({3-[4-(2,3-dimethylphenyl)piperazin-1-yl]pyrazin-2-yl}sulfanyl)acetamide
N-(2-chlorophenyl)-2-({3-[4-(2,3-dimethylphenyl)piperazin-1-yl]pyrazin-2-yl}sulfanyl)acetamide
Compound characteristics
| Compound ID: | L981-0582 |
| Compound Name: | N-(2-chlorophenyl)-2-({3-[4-(2,3-dimethylphenyl)piperazin-1-yl]pyrazin-2-yl}sulfanyl)acetamide |
| Molecular Weight: | 468.02 |
| Molecular Formula: | C24 H26 Cl N5 O S |
| Smiles: | Cc1cccc(c1C)N1CCN(CC1)c1c(nccn1)SCC(Nc1ccccc1[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 5.1514 |
| logD: | 5.1513 |
| logSw: | -5.4632 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.99 |
| InChI Key: | OAIBCVHEYQOJHY-UHFFFAOYSA-N |