2-{[3-(4-benzylpiperidin-1-yl)pyrazin-2-yl]sulfanyl}-N-(2,5-dimethoxyphenyl)acetamide
Chemical Structure Depiction of
2-{[3-(4-benzylpiperidin-1-yl)pyrazin-2-yl]sulfanyl}-N-(2,5-dimethoxyphenyl)acetamide
2-{[3-(4-benzylpiperidin-1-yl)pyrazin-2-yl]sulfanyl}-N-(2,5-dimethoxyphenyl)acetamide
Compound characteristics
| Compound ID: | L981-0876 |
| Compound Name: | 2-{[3-(4-benzylpiperidin-1-yl)pyrazin-2-yl]sulfanyl}-N-(2,5-dimethoxyphenyl)acetamide |
| Molecular Weight: | 478.61 |
| Molecular Formula: | C26 H30 N4 O3 S |
| Smiles: | COc1ccc(c(c1)NC(CSc1c(nccn1)N1CCC(CC1)Cc1ccccc1)=O)OC |
| Stereo: | ACHIRAL |
| logP: | 4.9961 |
| logD: | 4.9955 |
| logSw: | -4.7736 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.934 |
| InChI Key: | IUHGQDGYBDJSHU-UHFFFAOYSA-N |