N-[(4-methylphenyl)methyl]-4-(3-oxo-4-propyl-3,4-dihydropyrido[2,3-b]pyrazin-2-yl)benzamide
Chemical Structure Depiction of
N-[(4-methylphenyl)methyl]-4-(3-oxo-4-propyl-3,4-dihydropyrido[2,3-b]pyrazin-2-yl)benzamide
N-[(4-methylphenyl)methyl]-4-(3-oxo-4-propyl-3,4-dihydropyrido[2,3-b]pyrazin-2-yl)benzamide
Compound characteristics
| Compound ID: | L986-0915 |
| Compound Name: | N-[(4-methylphenyl)methyl]-4-(3-oxo-4-propyl-3,4-dihydropyrido[2,3-b]pyrazin-2-yl)benzamide |
| Molecular Weight: | 412.49 |
| Molecular Formula: | C25 H24 N4 O2 |
| Smiles: | CCCN1C(C(c2ccc(cc2)C(NCc2ccc(C)cc2)=O)=Nc2cccnc12)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6442 |
| logD: | 3.6442 |
| logSw: | -3.633 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.172 |
| InChI Key: | RQYHCUKEGCMDRS-UHFFFAOYSA-N |