N-[5-(2-{3-[(2,6-dimethylphenyl)sulfamoyl]-4-methylphenyl}ethenyl)-3-methyl-1,2-oxazol-4-yl]acetamide
Chemical Structure Depiction of
N-[5-(2-{3-[(2,6-dimethylphenyl)sulfamoyl]-4-methylphenyl}ethenyl)-3-methyl-1,2-oxazol-4-yl]acetamide
N-[5-(2-{3-[(2,6-dimethylphenyl)sulfamoyl]-4-methylphenyl}ethenyl)-3-methyl-1,2-oxazol-4-yl]acetamide
Compound characteristics
| Compound ID: | L991-0048 |
| Compound Name: | N-[5-(2-{3-[(2,6-dimethylphenyl)sulfamoyl]-4-methylphenyl}ethenyl)-3-methyl-1,2-oxazol-4-yl]acetamide |
| Molecular Weight: | 439.53 |
| Molecular Formula: | C23 H25 N3 O4 S |
| Smiles: | CC(Nc1c(C)noc1/C=C\c1ccc(C)c(c1)S(Nc1c(C)cccc1C)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.1366 |
| logD: | 2.9353 |
| logSw: | -3.2877 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 82.874 |
| InChI Key: | QMHSNSLIATZIRO-UHFFFAOYSA-N |