3-(3,4-dimethylphenyl)-5-{5-methyl-1-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-1H-1,2,3-triazol-4-yl}-1,2,4-oxadiazole
Chemical Structure Depiction of
3-(3,4-dimethylphenyl)-5-{5-methyl-1-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-1H-1,2,3-triazol-4-yl}-1,2,4-oxadiazole
3-(3,4-dimethylphenyl)-5-{5-methyl-1-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-1H-1,2,3-triazol-4-yl}-1,2,4-oxadiazole
Compound characteristics
| Compound ID: | M007-0016 |
| Compound Name: | 3-(3,4-dimethylphenyl)-5-{5-methyl-1-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-1H-1,2,3-triazol-4-yl}-1,2,4-oxadiazole |
| Molecular Weight: | 426.48 |
| Molecular Formula: | C24 H22 N6 O2 |
| Smiles: | Cc1ccc(cc1C)c1nc(c2c(C)n(Cc3c(C)oc(c4ccccc4)n3)nn2)on1 |
| Stereo: | ACHIRAL |
| logP: | 5.1076 |
| logD: | 5.1076 |
| logSw: | -5.0869 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 76.473 |
| InChI Key: | SARRMKNIHQILLE-UHFFFAOYSA-N |