3-(3,4-dimethylphenyl)-5-(5-methyl-1-{[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl}-1H-1,2,3-triazol-4-yl)-1,2,4-oxadiazole
Chemical Structure Depiction of
3-(3,4-dimethylphenyl)-5-(5-methyl-1-{[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl}-1H-1,2,3-triazol-4-yl)-1,2,4-oxadiazole
3-(3,4-dimethylphenyl)-5-(5-methyl-1-{[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl}-1H-1,2,3-triazol-4-yl)-1,2,4-oxadiazole
Compound characteristics
| Compound ID: | M007-0079 |
| Compound Name: | 3-(3,4-dimethylphenyl)-5-(5-methyl-1-{[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl}-1H-1,2,3-triazol-4-yl)-1,2,4-oxadiazole |
| Molecular Weight: | 440.5 |
| Molecular Formula: | C25 H24 N6 O2 |
| Smiles: | Cc1ccc(cc1)c1nc(Cn2c(C)c(c3nc(c4ccc(C)c(C)c4)no3)nn2)c(C)o1 |
| Stereo: | ACHIRAL |
| logP: | 5.6361 |
| logD: | 5.636 |
| logSw: | -5.5066 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 76.473 |
| InChI Key: | VRSRMPMAHBBWOL-UHFFFAOYSA-N |