N-{3-ethyl-4-[4-methoxy-3-(phenylsulfamoyl)phenyl]-1,2-oxazol-5-yl}acetamide
Chemical Structure Depiction of
N-{3-ethyl-4-[4-methoxy-3-(phenylsulfamoyl)phenyl]-1,2-oxazol-5-yl}acetamide
N-{3-ethyl-4-[4-methoxy-3-(phenylsulfamoyl)phenyl]-1,2-oxazol-5-yl}acetamide
Compound characteristics
| Compound ID: | M018-2755 |
| Compound Name: | N-{3-ethyl-4-[4-methoxy-3-(phenylsulfamoyl)phenyl]-1,2-oxazol-5-yl}acetamide |
| Molecular Weight: | 415.47 |
| Molecular Formula: | C20 H21 N3 O5 S |
| Smiles: | CCc1c(c2ccc(c(c2)S(Nc2ccccc2)(=O)=O)OC)c(NC(C)=O)on1 |
| Stereo: | ACHIRAL |
| logP: | 2.6646 |
| logD: | 2.6003 |
| logSw: | -3.2706 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 94.862 |
| InChI Key: | JKMMWCHOOAZZEZ-UHFFFAOYSA-N |