N-[3-ethyl-4-(4-methyl-3-{[3-(trifluoromethyl)phenyl]sulfamoyl}phenyl)-1,2-oxazol-5-yl]acetamide
Chemical Structure Depiction of
N-[3-ethyl-4-(4-methyl-3-{[3-(trifluoromethyl)phenyl]sulfamoyl}phenyl)-1,2-oxazol-5-yl]acetamide
N-[3-ethyl-4-(4-methyl-3-{[3-(trifluoromethyl)phenyl]sulfamoyl}phenyl)-1,2-oxazol-5-yl]acetamide
Compound characteristics
| Compound ID: | M018-2871 |
| Compound Name: | N-[3-ethyl-4-(4-methyl-3-{[3-(trifluoromethyl)phenyl]sulfamoyl}phenyl)-1,2-oxazol-5-yl]acetamide |
| Molecular Weight: | 467.47 |
| Molecular Formula: | C21 H20 F3 N3 O4 S |
| Smiles: | CCc1c(c2ccc(C)c(c2)S(Nc2cccc(c2)C(F)(F)F)(=O)=O)c(NC(C)=O)on1 |
| Stereo: | ACHIRAL |
| logP: | 4.4072 |
| logD: | 2.0942 |
| logSw: | -4.3878 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 87.232 |
| InChI Key: | GBGLVWGDXCQUEK-UHFFFAOYSA-N |