N-(4-bromo-2-methylphenyl)-4-(4,5-dimethyl-1,3-thiazol-2-yl)thiophene-2-sulfonamide
Chemical Structure Depiction of
N-(4-bromo-2-methylphenyl)-4-(4,5-dimethyl-1,3-thiazol-2-yl)thiophene-2-sulfonamide
N-(4-bromo-2-methylphenyl)-4-(4,5-dimethyl-1,3-thiazol-2-yl)thiophene-2-sulfonamide
Compound characteristics
| Compound ID: | M022-0959 |
| Compound Name: | N-(4-bromo-2-methylphenyl)-4-(4,5-dimethyl-1,3-thiazol-2-yl)thiophene-2-sulfonamide |
| Molecular Weight: | 443.4 |
| Molecular Formula: | C16 H15 Br N2 O2 S3 |
| Smiles: | Cc1cc(ccc1NS(c1cc(cs1)c1nc(C)c(C)s1)(=O)=O)[Br] |
| Stereo: | ACHIRAL |
| logP: | 5.3636 |
| logD: | 5.1853 |
| logSw: | -5.4974 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.519 |
| InChI Key: | MERAKBMWCKLBBJ-UHFFFAOYSA-N |