4-(4-tert-butyl-1,3-thiazol-2-yl)-N-(4-ethoxyphenyl)thiophene-2-sulfonamide
Chemical Structure Depiction of
4-(4-tert-butyl-1,3-thiazol-2-yl)-N-(4-ethoxyphenyl)thiophene-2-sulfonamide
4-(4-tert-butyl-1,3-thiazol-2-yl)-N-(4-ethoxyphenyl)thiophene-2-sulfonamide
Compound characteristics
| Compound ID: | M022-1670 |
| Compound Name: | 4-(4-tert-butyl-1,3-thiazol-2-yl)-N-(4-ethoxyphenyl)thiophene-2-sulfonamide |
| Molecular Weight: | 422.59 |
| Molecular Formula: | C19 H22 N2 O3 S3 |
| Smiles: | CCOc1ccc(cc1)NS(c1cc(cs1)c1nc(cs1)C(C)(C)C)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.7741 |
| logD: | 5.7698 |
| logSw: | -5.5518 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.764 |
| InChI Key: | YEBZWKBRGUGWEO-UHFFFAOYSA-N |