4-(4-tert-butyl-1,3-thiazol-2-yl)-N-[(2,5-dimethylphenyl)methyl]thiophene-2-sulfonamide
Chemical Structure Depiction of
4-(4-tert-butyl-1,3-thiazol-2-yl)-N-[(2,5-dimethylphenyl)methyl]thiophene-2-sulfonamide
4-(4-tert-butyl-1,3-thiazol-2-yl)-N-[(2,5-dimethylphenyl)methyl]thiophene-2-sulfonamide
Compound characteristics
| Compound ID: | M022-1796 |
| Compound Name: | 4-(4-tert-butyl-1,3-thiazol-2-yl)-N-[(2,5-dimethylphenyl)methyl]thiophene-2-sulfonamide |
| Molecular Weight: | 420.61 |
| Molecular Formula: | C20 H24 N2 O2 S3 |
| Smiles: | Cc1ccc(C)c(CNS(c2cc(cs2)c2nc(cs2)C(C)(C)C)(=O)=O)c1 |
| Stereo: | ACHIRAL |
| logP: | 6.3833 |
| logD: | 6.3782 |
| logSw: | -5.5335 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.749 |
| InChI Key: | OROOPPWDWMOUTH-UHFFFAOYSA-N |