4-(4-tert-butyl-1,3-thiazol-2-yl)-N-[(2-methylphenyl)methyl]thiophene-2-sulfonamide
Chemical Structure Depiction of
4-(4-tert-butyl-1,3-thiazol-2-yl)-N-[(2-methylphenyl)methyl]thiophene-2-sulfonamide
4-(4-tert-butyl-1,3-thiazol-2-yl)-N-[(2-methylphenyl)methyl]thiophene-2-sulfonamide
Compound characteristics
| Compound ID: | M022-1797 |
| Compound Name: | 4-(4-tert-butyl-1,3-thiazol-2-yl)-N-[(2-methylphenyl)methyl]thiophene-2-sulfonamide |
| Molecular Weight: | 406.59 |
| Molecular Formula: | C19 H22 N2 O2 S3 |
| Smiles: | Cc1ccccc1CNS(c1cc(cs1)c1nc(cs1)C(C)(C)C)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.9559 |
| logD: | 5.9508 |
| logSw: | -5.605 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.749 |
| InChI Key: | YAIVWHUADKFYTJ-UHFFFAOYSA-N |