N-[5-(2-{4-[(2-ethyl-6-methylphenyl)sulfamoyl]phenyl}ethenyl)-3-methyl-1,2-oxazol-4-yl]cyclopropanecarboxamide
Chemical Structure Depiction of
N-[5-(2-{4-[(2-ethyl-6-methylphenyl)sulfamoyl]phenyl}ethenyl)-3-methyl-1,2-oxazol-4-yl]cyclopropanecarboxamide
N-[5-(2-{4-[(2-ethyl-6-methylphenyl)sulfamoyl]phenyl}ethenyl)-3-methyl-1,2-oxazol-4-yl]cyclopropanecarboxamide
Compound characteristics
| Compound ID: | M026-1404 |
| Compound Name: | N-[5-(2-{4-[(2-ethyl-6-methylphenyl)sulfamoyl]phenyl}ethenyl)-3-methyl-1,2-oxazol-4-yl]cyclopropanecarboxamide |
| Molecular Weight: | 465.57 |
| Molecular Formula: | C25 H27 N3 O4 S |
| Smiles: | CCc1cccc(C)c1NS(c1ccc(\C=C/c2c(c(C)no2)NC(C2CC2)=O)cc1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.4429 |
| logD: | 4.4251 |
| logSw: | -4.2424 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 83.227 |
| InChI Key: | FPOSAHFPWSYVKH-UHFFFAOYSA-N |