N-[5-(2-{4-[(2-methoxyphenyl)sulfamoyl]phenyl}ethenyl)-3-methyl-1,2-oxazol-4-yl]cyclopropanecarboxamide
Chemical Structure Depiction of
N-[5-(2-{4-[(2-methoxyphenyl)sulfamoyl]phenyl}ethenyl)-3-methyl-1,2-oxazol-4-yl]cyclopropanecarboxamide
N-[5-(2-{4-[(2-methoxyphenyl)sulfamoyl]phenyl}ethenyl)-3-methyl-1,2-oxazol-4-yl]cyclopropanecarboxamide
Compound characteristics
| Compound ID: | M026-1479 |
| Compound Name: | N-[5-(2-{4-[(2-methoxyphenyl)sulfamoyl]phenyl}ethenyl)-3-methyl-1,2-oxazol-4-yl]cyclopropanecarboxamide |
| Molecular Weight: | 453.52 |
| Molecular Formula: | C23 H23 N3 O5 S |
| Smiles: | Cc1c(c(/C=C\c2ccc(cc2)S(Nc2ccccc2OC)(=O)=O)on1)NC(C1CC1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.5422 |
| logD: | 3.2223 |
| logSw: | -3.8978 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 91.555 |
| InChI Key: | MSQPNIDUNMPPLA-UHFFFAOYSA-N |