3-[2-(benzenesulfonyl)ethyl]-N-(2-methoxyethyl)-1,2,4-oxadiazole-5-carboxamide
Chemical Structure Depiction of
3-[2-(benzenesulfonyl)ethyl]-N-(2-methoxyethyl)-1,2,4-oxadiazole-5-carboxamide
3-[2-(benzenesulfonyl)ethyl]-N-(2-methoxyethyl)-1,2,4-oxadiazole-5-carboxamide
Compound characteristics
| Compound ID: | M027-0124 |
| Compound Name: | 3-[2-(benzenesulfonyl)ethyl]-N-(2-methoxyethyl)-1,2,4-oxadiazole-5-carboxamide |
| Molecular Weight: | 339.37 |
| Molecular Formula: | C14 H17 N3 O5 S |
| Smiles: | COCCNC(c1nc(CCS(c2ccccc2)(=O)=O)no1)=O |
| Stereo: | ACHIRAL |
| logP: | 0.4046 |
| logD: | 0.4046 |
| logSw: | -2.2298 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 94.811 |
| InChI Key: | ZMMMZTHJAKLRQO-UHFFFAOYSA-N |