N-(4-fluoro-2-methylphenyl)-3-[(1H-1,2,4-triazol-1-yl)methyl]benzamide
Chemical Structure Depiction of
N-(4-fluoro-2-methylphenyl)-3-[(1H-1,2,4-triazol-1-yl)methyl]benzamide
N-(4-fluoro-2-methylphenyl)-3-[(1H-1,2,4-triazol-1-yl)methyl]benzamide
Compound characteristics
| Compound ID: | M032-0179 |
| Compound Name: | N-(4-fluoro-2-methylphenyl)-3-[(1H-1,2,4-triazol-1-yl)methyl]benzamide |
| Molecular Weight: | 310.33 |
| Molecular Formula: | C17 H15 F N4 O |
| Smiles: | Cc1cc(ccc1NC(c1cccc(Cn2cncn2)c1)=O)F |
| Stereo: | ACHIRAL |
| logP: | 2.0973 |
| logD: | 2.0728 |
| logSw: | -2.63 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.609 |
| InChI Key: | WAXMDCVCRZLFGU-UHFFFAOYSA-N |