[4-(2-fluorophenyl)piperazin-1-yl][4-(2-methyl-1,3-thiazol-4-yl)phenyl]methanone
Chemical Structure Depiction of
[4-(2-fluorophenyl)piperazin-1-yl][4-(2-methyl-1,3-thiazol-4-yl)phenyl]methanone
[4-(2-fluorophenyl)piperazin-1-yl][4-(2-methyl-1,3-thiazol-4-yl)phenyl]methanone
Compound characteristics
| Compound ID: | M033-0175 |
| Compound Name: | [4-(2-fluorophenyl)piperazin-1-yl][4-(2-methyl-1,3-thiazol-4-yl)phenyl]methanone |
| Molecular Weight: | 381.47 |
| Molecular Formula: | C21 H20 F N3 O S |
| Smiles: | Cc1nc(cs1)c1ccc(cc1)C(N1CCN(CC1)c1ccccc1F)=O |
| Stereo: | ACHIRAL |
| logP: | 4.134 |
| logD: | 4.134 |
| logSw: | -4.1464 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 29.3865 |
| InChI Key: | XUCUKEBOTDGDJB-UHFFFAOYSA-N |