N-(2,5-dimethylphenyl)-4-(2-ethyl-1,3-thiazol-4-yl)benzamide
Chemical Structure Depiction of
N-(2,5-dimethylphenyl)-4-(2-ethyl-1,3-thiazol-4-yl)benzamide
N-(2,5-dimethylphenyl)-4-(2-ethyl-1,3-thiazol-4-yl)benzamide
Compound characteristics
| Compound ID: | M033-0409 |
| Compound Name: | N-(2,5-dimethylphenyl)-4-(2-ethyl-1,3-thiazol-4-yl)benzamide |
| Molecular Weight: | 336.45 |
| Molecular Formula: | C20 H20 N2 O S |
| Smiles: | CCc1nc(cs1)c1ccc(cc1)C(Nc1cc(C)ccc1C)=O |
| Stereo: | ACHIRAL |
| logP: | 5.0582 |
| logD: | 5.0582 |
| logSw: | -4.6094 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 32.861 |
| InChI Key: | ZPODZXYGTVNXEY-UHFFFAOYSA-N |