N-{3-[ethyl(phenyl)amino]propyl}-3-(1H-pyrrol-1-yl)thieno[2,3-b]pyridine-2-carboxamide
Chemical Structure Depiction of
N-{3-[ethyl(phenyl)amino]propyl}-3-(1H-pyrrol-1-yl)thieno[2,3-b]pyridine-2-carboxamide
N-{3-[ethyl(phenyl)amino]propyl}-3-(1H-pyrrol-1-yl)thieno[2,3-b]pyridine-2-carboxamide
Compound characteristics
| Compound ID: | M036-0218 |
| Compound Name: | N-{3-[ethyl(phenyl)amino]propyl}-3-(1H-pyrrol-1-yl)thieno[2,3-b]pyridine-2-carboxamide |
| Molecular Weight: | 404.53 |
| Molecular Formula: | C23 H24 N4 O S |
| Smiles: | CCN(CCCNC(c1c(c2cccnc2s1)n1cccc1)=O)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 4.5321 |
| logD: | 4.5065 |
| logSw: | -4.0035 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.02 |
| InChI Key: | QNTUISHDSIYETI-UHFFFAOYSA-N |