3-(4-methoxyphenyl)-5-{[4-(4-methylphenyl)-1,3-thiazol-2-yl]methyl}-1,2,4-oxadiazole
Chemical Structure Depiction of
3-(4-methoxyphenyl)-5-{[4-(4-methylphenyl)-1,3-thiazol-2-yl]methyl}-1,2,4-oxadiazole
3-(4-methoxyphenyl)-5-{[4-(4-methylphenyl)-1,3-thiazol-2-yl]methyl}-1,2,4-oxadiazole
Compound characteristics
| Compound ID: | M040-0262 |
| Compound Name: | 3-(4-methoxyphenyl)-5-{[4-(4-methylphenyl)-1,3-thiazol-2-yl]methyl}-1,2,4-oxadiazole |
| Molecular Weight: | 363.44 |
| Molecular Formula: | C20 H17 N3 O2 S |
| Smiles: | Cc1ccc(cc1)c1csc(Cc2nc(c3ccc(cc3)OC)no2)n1 |
| Stereo: | ACHIRAL |
| logP: | 5.924 |
| logD: | 5.924 |
| logSw: | -5.6522 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 49.083 |
| InChI Key: | HGCNQWSGNSCZOX-UHFFFAOYSA-N |