4-amino-N~3~-[(4-methylphenyl)methyl]-N~5~-(2-phenylpropyl)-1,2-thiazole-3,5-dicarboxamide
Chemical Structure Depiction of
4-amino-N~3~-[(4-methylphenyl)methyl]-N~5~-(2-phenylpropyl)-1,2-thiazole-3,5-dicarboxamide
4-amino-N~3~-[(4-methylphenyl)methyl]-N~5~-(2-phenylpropyl)-1,2-thiazole-3,5-dicarboxamide
Compound characteristics
| Compound ID: | M050-0825 |
| Compound Name: | 4-amino-N~3~-[(4-methylphenyl)methyl]-N~5~-(2-phenylpropyl)-1,2-thiazole-3,5-dicarboxamide |
| Molecular Weight: | 408.52 |
| Molecular Formula: | C22 H24 N4 O2 S |
| Smiles: | CC(CNC(c1c(c(C(NCc2ccc(C)cc2)=O)ns1)N)=O)c1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.8105 |
| logD: | 3.8105 |
| logSw: | -4.0026 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 4 |
| Polar surface area: | 79.713 |
| InChI Key: | RZKZYYAVCGGJJG-HNNXBMFYSA-N |