2-[(8-methoxy-5H-pyrimido[5,4-b]indol-4-yl)sulfanyl]acetamide
Chemical Structure Depiction of
2-[(8-methoxy-5H-pyrimido[5,4-b]indol-4-yl)sulfanyl]acetamide
2-[(8-methoxy-5H-pyrimido[5,4-b]indol-4-yl)sulfanyl]acetamide
Compound characteristics
| Compound ID: | M060-0571 |
| Compound Name: | 2-[(8-methoxy-5H-pyrimido[5,4-b]indol-4-yl)sulfanyl]acetamide |
| Molecular Weight: | 288.33 |
| Molecular Formula: | C13 H12 N4 O2 S |
| Smiles: | COc1ccc2c(c1)c1c(c(ncn1)SCC(N)=O)[nH]2 |
| Stereo: | ACHIRAL |
| logP: | 1.257 |
| logD: | 1.2559 |
| logSw: | -2.3651 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 71.703 |
| InChI Key: | AUPWWQDTKGIUCV-UHFFFAOYSA-N |