5-benzyl-2-[4-(4-methoxyphenyl)piperazine-1-carbonyl]thieno[3,2-c]pyridin-4(5H)-one
Chemical Structure Depiction of
5-benzyl-2-[4-(4-methoxyphenyl)piperazine-1-carbonyl]thieno[3,2-c]pyridin-4(5H)-one
5-benzyl-2-[4-(4-methoxyphenyl)piperazine-1-carbonyl]thieno[3,2-c]pyridin-4(5H)-one
Compound characteristics
| Compound ID: | M062-0791 |
| Compound Name: | 5-benzyl-2-[4-(4-methoxyphenyl)piperazine-1-carbonyl]thieno[3,2-c]pyridin-4(5H)-one |
| Molecular Weight: | 459.57 |
| Molecular Formula: | C26 H25 N3 O3 S |
| Smiles: | COc1ccc(cc1)N1CCN(CC1)C(c1cc2C(N(Cc3ccccc3)C=Cc2s1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.9136 |
| logD: | 3.9136 |
| logSw: | -4.0581 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 44.152 |
| InChI Key: | ZDYFFSZPXCCFGO-UHFFFAOYSA-N |