N-(2,5-dimethoxyphenyl)-2-methyl-5-[5-(trifluoromethyl)-1H-pyrazol-3-yl]thiophene-3-sulfonamide
Chemical Structure Depiction of
N-(2,5-dimethoxyphenyl)-2-methyl-5-[5-(trifluoromethyl)-1H-pyrazol-3-yl]thiophene-3-sulfonamide
N-(2,5-dimethoxyphenyl)-2-methyl-5-[5-(trifluoromethyl)-1H-pyrazol-3-yl]thiophene-3-sulfonamide
Compound characteristics
| Compound ID: | M089-0100 |
| Compound Name: | N-(2,5-dimethoxyphenyl)-2-methyl-5-[5-(trifluoromethyl)-1H-pyrazol-3-yl]thiophene-3-sulfonamide |
| Molecular Weight: | 447.45 |
| Molecular Formula: | C17 H16 F3 N3 O4 S2 |
| Smiles: | Cc1c(cc(c2cc(C(F)(F)F)[nH]n2)s1)S(Nc1cc(ccc1OC)OC)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2693 |
| logD: | 3.4957 |
| logSw: | -4.3999 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 78.872 |
| InChI Key: | UVHMMWFGLFZASJ-UHFFFAOYSA-N |