N-[(4-fluorophenyl)methyl]-2-methyl-5-[5-(trifluoromethyl)-1H-pyrazol-3-yl]thiophene-3-sulfonamide
Chemical Structure Depiction of
N-[(4-fluorophenyl)methyl]-2-methyl-5-[5-(trifluoromethyl)-1H-pyrazol-3-yl]thiophene-3-sulfonamide
N-[(4-fluorophenyl)methyl]-2-methyl-5-[5-(trifluoromethyl)-1H-pyrazol-3-yl]thiophene-3-sulfonamide
Compound characteristics
| Compound ID: | M089-0138 |
| Compound Name: | N-[(4-fluorophenyl)methyl]-2-methyl-5-[5-(trifluoromethyl)-1H-pyrazol-3-yl]thiophene-3-sulfonamide |
| Molecular Weight: | 419.42 |
| Molecular Formula: | C16 H13 F4 N3 O2 S2 |
| Smiles: | Cc1c(cc(c2cc(C(F)(F)F)[nH]n2)s1)S(NCc1ccc(cc1)F)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.3708 |
| logD: | 4.3637 |
| logSw: | -4.2453 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 65.505 |
| InChI Key: | DCLZYCBKBQWELU-UHFFFAOYSA-N |