N-(3,4-dimethoxyphenyl)-2,5-dimethyl-4-[5-(trifluoromethyl)-1,2-oxazol-3-yl]thiophene-3-sulfonamide
Chemical Structure Depiction of
N-(3,4-dimethoxyphenyl)-2,5-dimethyl-4-[5-(trifluoromethyl)-1,2-oxazol-3-yl]thiophene-3-sulfonamide
N-(3,4-dimethoxyphenyl)-2,5-dimethyl-4-[5-(trifluoromethyl)-1,2-oxazol-3-yl]thiophene-3-sulfonamide
Compound characteristics
| Compound ID: | M090-0006 |
| Compound Name: | N-(3,4-dimethoxyphenyl)-2,5-dimethyl-4-[5-(trifluoromethyl)-1,2-oxazol-3-yl]thiophene-3-sulfonamide |
| Molecular Weight: | 462.46 |
| Molecular Formula: | C18 H17 F3 N2 O5 S2 |
| Smiles: | Cc1c(c(c(C)s1)S(Nc1ccc(c(c1)OC)OC)(=O)=O)c1cc(C(F)(F)F)on1 |
| Stereo: | ACHIRAL |
| logP: | 4.2253 |
| logD: | 3.9233 |
| logSw: | -4.5816 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 78.702 |
| InChI Key: | FNLNBGWKQRGXAO-UHFFFAOYSA-N |