2,5-dimethyl-N-(2-phenylpropyl)-4-[5-(trifluoromethyl)-1,2-oxazol-3-yl]thiophene-3-sulfonamide
Chemical Structure Depiction of
2,5-dimethyl-N-(2-phenylpropyl)-4-[5-(trifluoromethyl)-1,2-oxazol-3-yl]thiophene-3-sulfonamide
2,5-dimethyl-N-(2-phenylpropyl)-4-[5-(trifluoromethyl)-1,2-oxazol-3-yl]thiophene-3-sulfonamide
Compound characteristics
| Compound ID: | M090-0146 |
| Compound Name: | 2,5-dimethyl-N-(2-phenylpropyl)-4-[5-(trifluoromethyl)-1,2-oxazol-3-yl]thiophene-3-sulfonamide |
| Molecular Weight: | 444.49 |
| Molecular Formula: | C19 H19 F3 N2 O3 S2 |
| Smiles: | CC(CNS(c1c(c2cc(C(F)(F)F)on2)c(C)sc1C)(=O)=O)c1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.5077 |
| logD: | 5.5074 |
| logSw: | -5.5827 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 64.55 |
| InChI Key: | ZBRLODVHUROTPD-NSHDSACASA-N |